C40H49FN6O3Si — CID 150335049
2-[[4-(8-azidooctoxy)-3-fluorophenyl]methyl]-8-benzyl-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]imidazo[1,2-a]pyrazin-3-ol (PubChem CID 150335049) has the molecular formula C40H49FN6O3Si and a molecular weight of 708.96 g/mol. Its IUPAC name is 2-[[4-(8-azidooctoxy)-3-fluorophenyl]methyl]-8-benzyl-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]imidazo[1,2-a]pyrazin-3-ol.
| Compound Name | 2-[[4-(8-azidooctoxy)-3-fluorophenyl]methyl]-8-benzyl-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]imidazo[1,2-a]pyrazin-3-ol |
|---|---|
| PubChem CID | 150335049 |
| Molecular Formula | C40H49FN6O3Si |
| Molecular Weight | 708.96 g/mol |
| Exact Mass | 708.36 |
| IUPAC Name | 2-[[4-(8-azidooctoxy)-3-fluorophenyl]methyl]-8-benzyl-6-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]imidazo[1,2-a]pyrazin-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2cn3c(O)c(Cc4ccc(OCCCCCCCCN=[N+]=[N-])c(F)c4)nc3c(Cc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C40H49FN6O3Si/c1-40(2,3)51(4,5)50-32-20-18-31(19-21-32)36-28-47-38(34(44-36)26-29-15-11-10-12-16-29)45-35(39(47)48)27-30-17-22-37(33(41)25-30)49-24-14-9-7-6-8-13-23-43-46-42/h10-12,15-22,25,28,48H,6-9,13-14,23-24,26-27H2,1-5H3 |
| InChIKey | YRIYKZQXTJCOGU-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.96 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|