C39H45FN4O4 — CID 137283519
tert-butyl N-[8-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]octyl]carbamate (PubChem CID 137283519) has the molecular formula C39H45FN4O4 and a molecular weight of 652.81 g/mol. Its IUPAC name is tert-butyl N-[8-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]octyl]carbamate.
| Compound Name | tert-butyl N-[8-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]octyl]carbamate |
|---|---|
| PubChem CID | 137283519 |
| Molecular Formula | C39H45FN4O4 |
| Molecular Weight | 652.81 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | tert-butyl N-[8-[4-[(8-benzyl-3-hydroxy-6-phenylimidazo[1,2-a]pyrazin-2-yl)methyl]-2-fluorophenoxy]octyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCCCOc1ccc(Cc2nc3c(Cc4ccccc4)nc(-c4ccccc4)cn3c2O)cc1F |
| InChI | InChI=1S/C39H45FN4O4/c1-39(2,3)48-38(46)41-22-14-6-4-5-7-15-23-47-35-21-20-29(24-31(35)40)26-33-37(45)44-27-34(30-18-12-9-13-19-30)42-32(36(44)43-33)25-28-16-10-8-11-17-28/h8-13,16-21,24,27,45H,4-7,14-15,22-23,25-26H2,1-3H3,(H,41,46) |
| InChIKey | ALRASZWRRKIHOA-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.81 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|