C18H20N2O8 — CID 137294210
[(6R,8aR)-8-acetyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate (PubChem CID 137294210) has the molecular formula C18H20N2O8 and a molecular weight of 392.36 g/mol. Its IUPAC name is [(6R,8aR)-8-acetyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate.
| Compound Name | [(6R,8aR)-8-acetyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate |
|---|---|
| PubChem CID | 137294210 |
| Molecular Formula | C18H20N2O8 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | [(6R,8aR)-8-acetyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl] 2-diazoacetate |
| SMILES | CO[C@@H]1OC2COC(c3ccccc3)O[C@H]2C(OC(C)=O)C1OC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C18H20N2O8/c1-10(21)25-15-14-12(9-24-17(28-14)11-6-4-3-5-7-11)26-18(23-2)16(15)27-13(22)8-20-19/h3-8,12,14-18H,9H2,1-2H3/t12?,14-,15?,16?,17?,18-/m1/s1 |
| InChIKey | JTAKCYDPKLGSLZ-LRMCXYOBSA-N |
| XLogP | 0.62 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|