C21H26N2O8 — CID 137295440
[(6R,8aS)-7-(2-diazoacetyl)oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate (PubChem CID 137295440) has the molecular formula C21H26N2O8 and a molecular weight of 434.45 g/mol. Its IUPAC name is [(6R,8aS)-7-(2-diazoacetyl)oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate.
| Compound Name | [(6R,8aS)-7-(2-diazoacetyl)oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137295440 |
| Molecular Formula | C21H26N2O8 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | [(6R,8aS)-7-(2-diazoacetyl)oxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1OC2COC(c3ccccc3)O[C@@H]2C(OC(=O)C(C)(C)C)C1OC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C21H26N2O8/c1-21(2,3)20(25)31-16-15-13(11-27-18(30-15)12-8-6-5-7-9-12)28-19(26-4)17(16)29-14(24)10-23-22/h5-10,13,15-19H,11H2,1-4H3/t13?,15-,16?,17?,18?,19+/m0/s1 |
| InChIKey | KQPBLEGDRFPHFF-HKEUHESLSA-N |
| XLogP | 1.64 |
| TPSA | 125.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|