C24H20N6OS — CID 137296928
N-[(Z)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]phenothiazine-10-carboxamide (PubChem CID 137296928) has the molecular formula C24H20N6OS and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[(Z)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]phenothiazine-10-carboxamide.
| Compound Name | N-[(Z)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]phenothiazine-10-carboxamide |
|---|---|
| PubChem CID | 137296928 |
| Molecular Formula | C24H20N6OS |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | N-[(Z)-N'-(4,6-dimethylquinazolin-2-yl)carbamimidoyl]phenothiazine-10-carboxamide |
| SMILES | Cc1ccc2nc(/N=C(/N)NC(=O)N3c4ccccc4Sc4ccccc43)nc(C)c2c1 |
| InChI | InChI=1S/C24H20N6OS/c1-14-11-12-17-16(13-14)15(2)26-23(27-17)28-22(25)29-24(31)30-18-7-3-5-9-20(18)32-21-10-6-4-8-19(21)30/h3-13H,1-2H3,(H3,25,26,27,28,29,31) |
| InChIKey | HWWYFDPOCUXWPV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 96.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|