C29H27CuNO2 — CID 137309253
copper;2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]-6-methylphenol (PubChem CID 137309253) has the molecular formula C29H27CuNO2 and a molecular weight of 485.09 g/mol. Its IUPAC name is copper;2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]-6-methylphenol.
| Compound Name | copper;2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]-6-methylphenol |
|---|---|
| PubChem CID | 137309253 |
| Molecular Formula | C29H27CuNO2 |
| Molecular Weight | 485.09 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | copper;2-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]-6-methylphenol |
| SMILES | Cc1cccc(/C=N\[C@@H](Cc2ccccc2)C(O)(c2ccccc2)c2ccccc2)c1O.[Cu] |
| InChI | InChI=1S/C29H27NO2.Cu/c1-22-12-11-15-24(28(22)31)21-30-27(20-23-13-5-2-6-14-23)29(32,25-16-7-3-8-17-25)26-18-9-4-10-19-26;/h2-19,21,27,31-32H,20H2,1H3;/b30-21-;/t27-;/m0./s1 |
| InChIKey | RNDNFVFMKHZLQU-NWGNKYDOSA-N |
| XLogP | 5.66 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.09 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|