C26H30N4O10S — CID 137316433
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-hydroxy-1-prop-2-enylindol-3-yl)iminocarbamothioylamino]oxan-2-yl]methyl acetate (PubChem CID 137316433) has the molecular formula C26H30N4O10S and a molecular weight of 590.61 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-hydroxy-1-prop-2-enylindol-3-yl)iminocarbamothioylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-hydroxy-1-prop-2-enylindol-3-yl)iminocarbamothioylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 137316433 |
| Molecular Formula | C26H30N4O10S |
| Molecular Weight | 590.61 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[(2-hydroxy-1-prop-2-enylindol-3-yl)iminocarbamothioylamino]oxan-2-yl]methyl acetate |
| SMILES | C=CCn1c(O)c(/N=N/C(=S)N[C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)c2ccccc21 |
| InChI | InChI=1S/C26H30N4O10S/c1-6-11-30-18-10-8-7-9-17(18)20(25(30)35)28-29-26(41)27-24-23(39-16(5)34)22(38-15(4)33)21(37-14(3)32)19(40-24)12-36-13(2)31/h6-10,19,21-24,35H,1,11-12H2,2-5H3,(H,27,41)/b29-28+/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | UHSXZFAZUWPGJM-HSVADOOLSA-N |
| XLogP | 2.57 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|