C15H23FN4O2 — CID 137345753
5-fluoro-4-methoxy-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine (PubChem CID 137345753) has the molecular formula C15H23FN4O2 and a molecular weight of 310.37 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-methoxy-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 137345753 |
| Molecular Formula | C15H23FN4O2 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 5-fluoro-4-methoxy-N-[1-(oxolan-2-ylmethyl)piperidin-4-yl]pyrimidin-2-amine |
| SMILES | COc1nc(NC2CCN(CC3CCCO3)CC2)ncc1F |
| InChI | InChI=1S/C15H23FN4O2/c1-21-14-13(16)9-17-15(19-14)18-11-4-6-20(7-5-11)10-12-3-2-8-22-12/h9,11-12H,2-8,10H2,1H3,(H,17,18,19) |
| InChIKey | LRRPOGCTCSWWHG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |