2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid

C13H17NO5 — CID 137352305

IUPAC2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid
SMILESCC(CCC(=O)NCC(=O)O)c1ccc(O)cc1O
InChIInChI=1S/C13H17NO5/c1-8(2-5-12(17)14-7-13(18)19)10-4-3-9(15)6-11(10)16/h3-4,6,8,15-16H,2,5,7H2,1H3,(H,14,17)(H,18,19)
InChIKeyDVUUVXOEJVVYNT-UHFFFAOYSA-N
MW267.28 g/mol
LogP1.18
Rot. Bonds6

About 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid

2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid (PubChem CID 137352305) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid.

Molecular Properties

Compound Name2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid
PubChem CID137352305
Molecular FormulaC13H17NO5
Molecular Weight267.28 g/mol
Exact Mass267.11
IUPAC Name2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid
SMILESCC(CCC(=O)NCC(=O)O)c1ccc(O)cc1O
InChIInChI=1S/C13H17NO5/c1-8(2-5-12(17)14-7-13(18)19)10-4-3-9(15)6-11(10)16/h3-4,6,8,15-16H,2,5,7H2,1H3,(H,14,17)(H,18,19)
InChIKeyDVUUVXOEJVVYNT-UHFFFAOYSA-N
XLogP1.18
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 51.18
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid?
The IUPAC name of 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid (CID 137352305) is 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid.
What is the SMILES notation for 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid?
The canonical SMILES for 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid is CC(CCC(=O)NCC(=O)O)c1ccc(O)cc1O.
What is the InChIKey of 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid?
The InChIKey is DVUUVXOEJVVYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO5/c1-8(2-5-12(17)14-7-13(18)19)10-4-3-9(15)6-11(10)16/h3-4,6,8,15-16H,2,5,7H2,1H3,(H,14,17)(H,18,19).
What are the key properties of 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid?
2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid has a molecular weight of 267.28 g/mol, XLogP of 1.18, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,4-dihydroxyphenyl)pentanoylamino]acetic acid is sourced from PubChem (CID 137352305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).