C16H23NO5 — CID 137352793
ethyl (2R)-2-[4-(2,4-dihydroxyphenyl)pentanoylamino]propanoate (PubChem CID 137352793) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is ethyl (2R)-2-[4-(2,4-dihydroxyphenyl)pentanoylamino]propanoate.
| Compound Name | ethyl (2R)-2-[4-(2,4-dihydroxyphenyl)pentanoylamino]propanoate |
|---|---|
| PubChem CID | 137352793 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | ethyl (2R)-2-[4-(2,4-dihydroxyphenyl)pentanoylamino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NC(=O)CCC(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H23NO5/c1-4-22-16(21)11(3)17-15(20)8-5-10(2)13-7-6-12(18)9-14(13)19/h6-7,9-11,18-19H,4-5,8H2,1-3H3,(H,17,20)/t10?,11-/m1/s1 |
| InChIKey | IRGQFUAGNUBHET-RRKGBCIJSA-N |
| XLogP | 2.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |