C12H18O2 — CID 66695243
4-hexan-2-ylbenzene-1,3-diol (PubChem CID 66695243) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 4-hexan-2-ylbenzene-1,3-diol.
| Compound Name | 4-hexan-2-ylbenzene-1,3-diol |
|---|---|
| PubChem CID | 66695243 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 4-hexan-2-ylbenzene-1,3-diol |
| SMILES | CCCCC(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C12H18O2/c1-3-4-5-9(2)11-7-6-10(13)8-12(11)14/h6-9,13-14H,3-5H2,1-2H3 |
| InChIKey | FWCKHFTXEFRAIE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |