C26H47NO6 — CID 142486312
ethane;3-[(2-hydroxy-3,3-dimethylhexanoyl)amino]propyl 4-(2,4-dihydroxyphenyl)pentanoate (PubChem CID 142486312) has the molecular formula C26H47NO6 and a molecular weight of 469.66 g/mol. Its IUPAC name is ethane;3-[(2-hydroxy-3,3-dimethylhexanoyl)amino]propyl 4-(2,4-dihydroxyphenyl)pentanoate.
| Compound Name | ethane;3-[(2-hydroxy-3,3-dimethylhexanoyl)amino]propyl 4-(2,4-dihydroxyphenyl)pentanoate |
|---|---|
| PubChem CID | 142486312 |
| Molecular Formula | C26H47NO6 |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | ethane;3-[(2-hydroxy-3,3-dimethylhexanoyl)amino]propyl 4-(2,4-dihydroxyphenyl)pentanoate |
| SMILES | CC.CC.CCCC(C)(C)C(O)C(=O)NCCCOC(=O)CCC(C)c1ccc(O)cc1O |
| InChI | InChI=1S/C22H35NO6.2C2H6/c1-5-11-22(3,4)20(27)21(28)23-12-6-13-29-19(26)10-7-15(2)17-9-8-16(24)14-18(17)25;2*1-2/h8-9,14-15,20,24-25,27H,5-7,10-13H2,1-4H3,(H,23,28);2*1-2H3 |
| InChIKey | RWUMTVCJRIRANI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|