C16H24O8 — CID 146523999
2,3,4,5-tetrahydroxypentyl 4-(2,4-dihydroxyphenyl)pentanoate (PubChem CID 146523999) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxypentyl 4-(2,4-dihydroxyphenyl)pentanoate.
| Compound Name | 2,3,4,5-tetrahydroxypentyl 4-(2,4-dihydroxyphenyl)pentanoate |
|---|---|
| PubChem CID | 146523999 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2,3,4,5-tetrahydroxypentyl 4-(2,4-dihydroxyphenyl)pentanoate |
| SMILES | CC(CCC(=O)OCC(O)C(O)C(O)CO)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H24O8/c1-9(11-4-3-10(18)6-12(11)19)2-5-15(22)24-8-14(21)16(23)13(20)7-17/h3-4,6,9,13-14,16-21,23H,2,5,7-8H2,1H3 |
| InChIKey | RSNCQKFPWOKSIO-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |