C21H25N3O5S — CID 137356416
[4-[[2-(thiomorpholine-4-carbonyl)-1-benzofuran-5-yl]carbamoyl]cyclohexyl] carbamate (PubChem CID 137356416) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is [4-[[2-(thiomorpholine-4-carbonyl)-1-benzofuran-5-yl]carbamoyl]cyclohexyl] carbamate.
| Compound Name | [4-[[2-(thiomorpholine-4-carbonyl)-1-benzofuran-5-yl]carbamoyl]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 137356416 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [4-[[2-(thiomorpholine-4-carbonyl)-1-benzofuran-5-yl]carbamoyl]cyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCC(C(=O)Nc2ccc3oc(C(=O)N4CCSCC4)cc3c2)CC1 |
| InChI | InChI=1S/C21H25N3O5S/c22-21(27)28-16-4-1-13(2-5-16)19(25)23-15-3-6-17-14(11-15)12-18(29-17)20(26)24-7-9-30-10-8-24/h3,6,11-13,16H,1-2,4-5,7-10H2,(H2,22,27)(H,23,25) |
| InChIKey | YRVHBBLGYWUEMI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |