C11H17ClN4O2 — CID 137357347
tert-butyl N-[2-(2-chloropyrimidin-5-yl)ethylamino]carbamate (PubChem CID 137357347) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is tert-butyl N-[2-(2-chloropyrimidin-5-yl)ethylamino]carbamate.
| Compound Name | tert-butyl N-[2-(2-chloropyrimidin-5-yl)ethylamino]carbamate |
|---|---|
| PubChem CID | 137357347 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | tert-butyl N-[2-(2-chloropyrimidin-5-yl)ethylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNCCc1cnc(Cl)nc1 |
| InChI | InChI=1S/C11H17ClN4O2/c1-11(2,3)18-10(17)16-15-5-4-8-6-13-9(12)14-7-8/h6-7,15H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | HDZAFZNIWDVISZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|