C11H19F3N2O3 — CID 137358863
tert-butyl N-[[2-(trifluoromethyl)oxan-4-yl]amino]carbamate (PubChem CID 137358863) has the molecular formula C11H19F3N2O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is tert-butyl N-[[2-(trifluoromethyl)oxan-4-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[2-(trifluoromethyl)oxan-4-yl]amino]carbamate |
|---|---|
| PubChem CID | 137358863 |
| Molecular Formula | C11H19F3N2O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | tert-butyl N-[[2-(trifluoromethyl)oxan-4-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1CCOC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H19F3N2O3/c1-10(2,3)19-9(17)16-15-7-4-5-18-8(6-7)11(12,13)14/h7-8,15H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | RHTSOALAJJDCFZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|