About 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc
2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc (PubChem CID 137373020) has the molecular formula C9H19NS2Zn
and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc.
Molecular Properties
| Compound Name | 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc |
| PubChem CID | 137373020 |
| Molecular Formula | C9H19NS2Zn |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc |
| SMILES | CC(C)CNC(=S)SCC(C)C.[Zn] |
| InChI | InChI=1S/C9H19NS2.Zn/c1-7(2)5-10-9(11)12-6-8(3)4;/h7-8H,5-6H2,1-4H3,(H,10,11); |
| InChIKey | TWARFSHITYOYRY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc?
The IUPAC name of 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc (CID 137373020) is 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc.
What is the SMILES notation for 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc?
The canonical SMILES for 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc is CC(C)CNC(=S)SCC(C)C.[Zn].
What is the InChIKey of 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc?
The InChIKey is TWARFSHITYOYRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NS2.Zn/c1-7(2)5-10-9(11)12-6-8(3)4;/h7-8H,5-6H2,1-4H3,(H,10,11);.
What are the key properties of 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc?
2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc has a molecular weight of 270.78 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl N-(2-methylpropyl)carbamodithioate;zinc is sourced from PubChem (CID 137373020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).