C9H18N2OS2 — CID 59072300
ethyl N-[2-(propanoylamino)propyl]carbamodithioate (PubChem CID 59072300) has the molecular formula C9H18N2OS2 and a molecular weight of 234.39 g/mol. Its IUPAC name is ethyl N-[2-(propanoylamino)propyl]carbamodithioate.
| Compound Name | ethyl N-[2-(propanoylamino)propyl]carbamodithioate |
|---|---|
| PubChem CID | 59072300 |
| Molecular Formula | C9H18N2OS2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | ethyl N-[2-(propanoylamino)propyl]carbamodithioate |
| SMILES | CCSC(=S)NCC(C)NC(=O)CC |
| InChI | InChI=1S/C9H18N2OS2/c1-4-8(12)11-7(3)6-10-9(13)14-5-2/h7H,4-6H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | QWKPTWNQUINQTC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|