C5H8N2OS3Zn — CID 21357618
zinc N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamothioate (PubChem CID 21357618) has the molecular formula C5H8N2OS3Zn and a molecular weight of 273.72 g/mol. Its IUPAC name is zinc N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamothioate.
| Compound Name | zinc N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamothioate |
|---|---|
| PubChem CID | 21357618 |
| Molecular Formula | C5H8N2OS3Zn |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 271.91 |
| IUPAC Name | zinc N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamothioate |
| SMILES | CC(CNC(=S)[S-])NC(=O)[S-].[Zn+2] |
| InChI | InChI=1S/C5H10N2OS3.Zn/c1-3(7-4(8)9)2-6-5(10)11;/h3H,2H2,1H3,(H2,6,10,11)(H2,7,8,9);/q;+2/p-2 |
| InChIKey | HAWACZIEUFLVBP-UHFFFAOYSA-L |
| XLogP | 0.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|