C7H16N2S3SiZn — CID 163802443
zinc;carbanide;N-[2-(methylsilylcarbothioylamino)propyl]carbamodithioate (PubChem CID 163802443) has the molecular formula C7H16N2S3SiZn and a molecular weight of 317.90 g/mol. Its IUPAC name is zinc;carbanide;N-[2-(methylsilylcarbothioylamino)propyl]carbamodithioate.
| Compound Name | zinc;carbanide;N-[2-(methylsilylcarbothioylamino)propyl]carbamodithioate |
|---|---|
| PubChem CID | 163802443 |
| Molecular Formula | C7H16N2S3SiZn |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | zinc;carbanide;N-[2-(methylsilylcarbothioylamino)propyl]carbamodithioate |
| SMILES | C[SiH2]C(=S)NC(C)CNC(=S)[S-].[CH3-].[Zn+2] |
| InChI | InChI=1S/C6H14N2S3Si.CH3.Zn/c1-4(3-7-5(9)10)8-6(11)12-2;;/h4H,3,12H2,1-2H3,(H,8,11)(H2,7,9,10);1H3;/q;-1;+2/p-1 |
| InChIKey | VNXBTSYLALUXOW-UHFFFAOYSA-M |
| XLogP | 0.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|