C5H9N2S4Zn+ — CID 159161097
zinc N-[2-(dithiocarboxyamino)propyl]carbamodithioate (PubChem CID 159161097) has the molecular formula C5H9N2S4Zn+ and a molecular weight of 290.80 g/mol. Its IUPAC name is zinc N-[2-(dithiocarboxyamino)propyl]carbamodithioate.
| Compound Name | zinc N-[2-(dithiocarboxyamino)propyl]carbamodithioate |
|---|---|
| PubChem CID | 159161097 |
| Molecular Formula | C5H9N2S4Zn+ |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 288.89 |
| IUPAC Name | zinc N-[2-(dithiocarboxyamino)propyl]carbamodithioate |
| SMILES | CC(CNC(=S)[S-])NC(=S)S.[Zn+2] |
| InChI | InChI=1S/C5H10N2S4.Zn/c1-3(7-5(10)11)2-6-4(8)9;/h3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11);/q;+2/p-1 |
| InChIKey | KKMLIVYBGSAJPM-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|