C12H23NOS3 — CID 143867536
N-(2,4-dimethylpentyl)-2-ethylsulfanylcarbothioylsulfanylacetamide (PubChem CID 143867536) has the molecular formula C12H23NOS3 and a molecular weight of 293.52 g/mol. Its IUPAC name is N-(2,4-dimethylpentyl)-2-ethylsulfanylcarbothioylsulfanylacetamide.
| Compound Name | N-(2,4-dimethylpentyl)-2-ethylsulfanylcarbothioylsulfanylacetamide |
|---|---|
| PubChem CID | 143867536 |
| Molecular Formula | C12H23NOS3 |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | N-(2,4-dimethylpentyl)-2-ethylsulfanylcarbothioylsulfanylacetamide |
| SMILES | CCSC(=S)SCC(=O)NCC(C)CC(C)C |
| InChI | InChI=1S/C12H23NOS3/c1-5-16-12(15)17-8-11(14)13-7-10(4)6-9(2)3/h9-10H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | XRIWAUJQIWIVGO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|