C16H33N3O4 — CID 137379314
tert-butyl 2-[[amino(2-methylpropyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 137379314) has the molecular formula C16H33N3O4 and a molecular weight of 331.46 g/mol. Its IUPAC name is tert-butyl 2-[[amino(2-methylpropyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | tert-butyl 2-[[amino(2-methylpropyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 137379314 |
| Molecular Formula | C16H33N3O4 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | tert-butyl 2-[[amino(2-methylpropyl)carbamoyl]amino]-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CC(C)CN(N)C(=O)NC(COC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H33N3O4/c1-11(2)9-19(17)14(21)18-12(10-22-15(3,4)5)13(20)23-16(6,7)8/h11-12H,9-10,17H2,1-8H3,(H,18,21) |
| InChIKey | QBKJONSOWPTYIP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|