C26H30FN3O3S — CID 137383191
4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexa-1,5-dien-1-yl]-N-methylsulfanylcyclohex-3-en-1-amine (PubChem CID 137383191) has the molecular formula C26H30FN3O3S and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexa-1,5-dien-1-yl]-N-methylsulfanylcyclohex-3-en-1-amine.
| Compound Name | 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexa-1,5-dien-1-yl]-N-methylsulfanylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 137383191 |
| Molecular Formula | C26H30FN3O3S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 4-[4-[2-[[(3aR,6aS)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]cyclohexa-1,5-dien-1-yl]-N-methylsulfanylcyclohex-3-en-1-amine |
| SMILES | CSNC1CC=C(C2=CCC(c3nc4cc(OC5CO[C@@H]6CCO[C@H]56)[nH]c4cc3F)C=C2)CC1 |
| InChI | InChI=1S/C26H30FN3O3S/c1-34-30-18-8-6-16(7-9-18)15-2-4-17(5-3-15)25-19(27)12-20-21(29-25)13-24(28-20)33-23-14-32-22-10-11-31-26(22)23/h2-4,6,12-13,17-18,22-23,26,28,30H,5,7-11,14H2,1H3/t17?,18?,22-,23?,26+/m1/s1 |
| InChIKey | SKYNSYGRWCCZPZ-MFZCTSDKSA-N |
| XLogP | 4.95 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|