C27H30ClN3O3S — CID 144691071
(3S,6R,6aS)-6-[[6-chloro-5-[4-[4-(methylsulfanylamino)cyclohexen-1-yl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol (PubChem CID 144691071) has the molecular formula C27H30ClN3O3S and a molecular weight of 512.08 g/mol. Its IUPAC name is (3S,6R,6aS)-6-[[6-chloro-5-[4-[4-(methylsulfanylamino)cyclohexen-1-yl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol.
| Compound Name | (3S,6R,6aS)-6-[[6-chloro-5-[4-[4-(methylsulfanylamino)cyclohexen-1-yl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
|---|---|
| PubChem CID | 144691071 |
| Molecular Formula | C27H30ClN3O3S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (3S,6R,6aS)-6-[[6-chloro-5-[4-[4-(methylsulfanylamino)cyclohexen-1-yl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
| SMILES | CSNC1CC=C(c2ccc(-c3nc4cc(O[C@@H]5CCC6[C@H](O)CO[C@@H]65)[nH]c4cc3Cl)cc2)CC1 |
| InChI | InChI=1S/C27H30ClN3O3S/c1-35-31-18-8-6-16(7-9-18)15-2-4-17(5-3-15)26-20(28)12-21-22(30-26)13-25(29-21)34-24-11-10-19-23(32)14-33-27(19)24/h2-6,12-13,18-19,23-24,27,29,31-32H,7-11,14H2,1H3/t18?,19?,23-,24-,27+/m1/s1 |
| InChIKey | UMGATFIXPJUNOY-ILTGZOKSSA-N |
| XLogP | 5.60 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|