C23H27ClN2O4 — CID 145024109
(3S,6R,6aS)-6-[[6-chloro-5-(phenoxymethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol;ethane (PubChem CID 145024109) has the molecular formula C23H27ClN2O4 and a molecular weight of 430.93 g/mol. Its IUPAC name is (3S,6R,6aS)-6-[[6-chloro-5-(phenoxymethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol;ethane.
| Compound Name | (3S,6R,6aS)-6-[[6-chloro-5-(phenoxymethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol;ethane |
|---|---|
| PubChem CID | 145024109 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (3S,6R,6aS)-6-[[6-chloro-5-(phenoxymethyl)-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol;ethane |
| SMILES | CC.O[C@@H]1CO[C@H]2C1CC[C@H]2Oc1cc2nc(COc3ccccc3)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C21H21ClN2O4.C2H6/c22-14-8-15-16(23-17(14)10-26-12-4-2-1-3-5-12)9-20(24-15)28-19-7-6-13-18(25)11-27-21(13)19;1-2/h1-5,8-9,13,18-19,21,24-25H,6-7,10-11H2;1-2H3/t13?,18-,19-,21+;/m1./s1 |
| InChIKey | HDTHIWVCCYNGLG-SIVRTIINSA-N |
| XLogP | 4.74 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |