C27H28FN3O3 — CID 145024407
(3S,6R,6aS)-6-[[5-[4-(8-azabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol (PubChem CID 145024407) has the molecular formula C27H28FN3O3 and a molecular weight of 461.54 g/mol. Its IUPAC name is (3S,6R,6aS)-6-[[5-[4-(8-azabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol.
| Compound Name | (3S,6R,6aS)-6-[[5-[4-(8-azabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
|---|---|
| PubChem CID | 145024407 |
| Molecular Formula | C27H28FN3O3 |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | (3S,6R,6aS)-6-[[5-[4-(8-azabicyclo[3.2.1]oct-2-en-3-yl)phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2C1CC[C@H]2Oc1cc2nc(-c3ccc(C4=CC5CCC(C4)N5)cc3)c(F)cc2[nH]1 |
| InChI | InChI=1S/C27H28FN3O3/c28-20-11-21-22(12-25(30-21)34-24-8-7-19-23(32)13-33-27(19)24)31-26(20)15-3-1-14(2-4-15)16-9-17-5-6-18(10-16)29-17/h1-4,9,11-12,17-19,23-24,27,29-30,32H,5-8,10,13H2/t17?,18?,19?,23-,24-,27+/m1/s1 |
| InChIKey | HOZCEZVYJQVHDJ-QLCFRVGZSA-N |
| XLogP | 4.19 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |