C13H13F3N2O — CID 137385078
6-(trifluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazol-1-amine (PubChem CID 137385078) has the molecular formula C13H13F3N2O and a molecular weight of 270.25 g/mol. Its IUPAC name is 6-(trifluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazol-1-amine.
| Compound Name | 6-(trifluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
|---|---|
| PubChem CID | 137385078 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 6-(trifluoromethoxy)-2,3,4,9-tetrahydro-1H-carbazol-1-amine |
| SMILES | NC1CCCc2c1[nH]c1ccc(OC(F)(F)F)cc21 |
| InChI | InChI=1S/C13H13F3N2O/c14-13(15,16)19-7-4-5-11-9(6-7)8-2-1-3-10(17)12(8)18-11/h4-6,10,18H,1-3,17H2 |
| InChIKey | AXMQQYGDUMLKBR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|