C13H16N2O — CID 153493829
(8-amino-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanol (PubChem CID 153493829) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (8-amino-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanol.
| Compound Name | (8-amino-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanol |
|---|---|
| PubChem CID | 153493829 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (8-amino-6,7,8,9-tetrahydro-5H-carbazol-3-yl)methanol |
| SMILES | NC1CCCc2c1[nH]c1ccc(CO)cc21 |
| InChI | InChI=1S/C13H16N2O/c14-11-3-1-2-9-10-6-8(7-16)4-5-12(10)15-13(9)11/h4-6,11,15-16H,1-3,7,14H2 |
| InChIKey | CLPTWGQJDRCACB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|