C40H39Cl — CID 137388241
2',7'-ditert-butyl-1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)-9,9'-spirobi[fluorene] (PubChem CID 137388241) has the molecular formula C40H39Cl and a molecular weight of 555.21 g/mol. Its IUPAC name is 2',7'-ditert-butyl-1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)-9,9'-spirobi[fluorene].
| Compound Name | 2',7'-ditert-butyl-1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)-9,9'-spirobi[fluorene] |
|---|---|
| PubChem CID | 137388241 |
| Molecular Formula | C40H39Cl |
| Molecular Weight | 555.21 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | 2',7'-ditert-butyl-1-(4-chloro-4-methylcyclohexa-1,5-dien-1-yl)-9,9'-spirobi[fluorene] |
| SMILES | CC1(Cl)C=CC(c2cccc3c2C2(c4cc(C(C)(C)C)ccc4-c4ccc(C(C)(C)C)cc42)c2ccccc2-3)=CC1 |
| InChI | InChI=1S/C40H39Cl/c1-37(2,3)26-15-17-30-31-18-16-27(38(4,5)6)24-35(31)40(34(30)23-26)33-14-9-8-11-29(33)32-13-10-12-28(36(32)40)25-19-21-39(7,41)22-20-25/h8-21,23-24H,22H2,1-7H3 |
| InChIKey | VBSVIIDFNGKDFZ-UHFFFAOYSA-N |
| XLogP | 10.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.21 |
| LogP ≤ 5 | 10.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|