C25H40O8 — CID 137402133
methyl 3-[(2S,4R,6R)-6-[[(1S,3R,8R,10S,12S,13R,14R)-13-hydroxy-6,6,14-trimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate (PubChem CID 137402133) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is methyl 3-[(2S,4R,6R)-6-[[(1S,3R,8R,10S,12S,13R,14R)-13-hydroxy-6,6,14-trimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,4R,6R)-6-[[(1S,3R,8R,10S,12S,13R,14R)-13-hydroxy-6,6,14-trimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate |
|---|---|
| PubChem CID | 137402133 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | methyl 3-[(2S,4R,6R)-6-[[(1S,3R,8R,10S,12S,13R,14R)-13-hydroxy-6,6,14-trimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanoate |
| SMILES | C=C1[C@H](C)C[C@H](CCC(=O)OC)O[C@@H]1C[C@@H]1O[C@H]2C[C@H]3OC(C)(C)OC[C@H]3O[C@H]2[C@H](C)[C@H]1O |
| InChI | InChI=1S/C25H40O8/c1-13-9-16(7-8-22(26)28-6)30-17(14(13)2)10-19-23(27)15(3)24-20(31-19)11-18-21(32-24)12-29-25(4,5)33-18/h13,15-21,23-24,27H,2,7-12H2,1,3-6H3/t13-,15-,16+,17-,18-,19+,20+,21-,23-,24+/m1/s1 |
| InChIKey | JWOXJBFVKWQIMV-ISYFPQRVSA-N |
| XLogP | 2.75 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|