C23H34O7 — CID 167263598
3-[(6R)-6-[(13-hydroxy-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl)methyl]-4,5-dimethylideneoxan-2-yl]propanal (PubChem CID 167263598) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is 3-[(6R)-6-[(13-hydroxy-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl)methyl]-4,5-dimethylideneoxan-2-yl]propanal.
| Compound Name | 3-[(6R)-6-[(13-hydroxy-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl)methyl]-4,5-dimethylideneoxan-2-yl]propanal |
|---|---|
| PubChem CID | 167263598 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 3-[(6R)-6-[(13-hydroxy-6,6-dimethyl-2,5,7,11-tetraoxatricyclo[8.4.0.03,8]tetradecan-12-yl)methyl]-4,5-dimethylideneoxan-2-yl]propanal |
| SMILES | C=C1CC(CCC=O)O[C@H](CC2OC3CC4OC(C)(C)OCC4OC3CC2O)C1=C |
| InChI | InChI=1S/C23H34O7/c1-13-8-15(6-5-7-24)27-17(14(13)2)10-18-16(25)9-19-20(28-18)11-21-22(29-19)12-26-23(3,4)30-21/h7,15-22,25H,1-2,5-6,8-12H2,3-4H3/t15?,16?,17-,18?,19?,20?,21?,22?/m1/s1 |
| InChIKey | JSQBEMUGILOPJY-YJWJCOGNSA-N |
| XLogP | 2.45 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|