C25H40O6 — CID 161283620
[6-ethyl-4,7-dimethyl-2-[[4-methyl-3-methylidene-6-(3-oxopropyl)oxan-2-yl]methyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate (PubChem CID 161283620) has the molecular formula C25H40O6 and a molecular weight of 436.59 g/mol. Its IUPAC name is [6-ethyl-4,7-dimethyl-2-[[4-methyl-3-methylidene-6-(3-oxopropyl)oxan-2-yl]methyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate.
| Compound Name | [6-ethyl-4,7-dimethyl-2-[[4-methyl-3-methylidene-6-(3-oxopropyl)oxan-2-yl]methyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate |
|---|---|
| PubChem CID | 161283620 |
| Molecular Formula | C25H40O6 |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | [6-ethyl-4,7-dimethyl-2-[[4-methyl-3-methylidene-6-(3-oxopropyl)oxan-2-yl]methyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-3-yl] acetate |
| SMILES | C=C1C(C)CC(CCC=O)OC1CC1OC2CC(C)C(CC)OC2C(C)C1OC(C)=O |
| InChI | InChI=1S/C25H40O6/c1-7-20-15(3)12-22-25(31-20)17(5)24(28-18(6)27)23(30-22)13-21-16(4)14(2)11-19(29-21)9-8-10-26/h10,14-15,17,19-25H,4,7-9,11-13H2,1-3,5-6H3 |
| InChIKey | XPUWKGFVBKWKHI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|