C19H23NO6 — CID 137407851
(5S)-2,3-dimethylidene-6-oxo-5-(phenylmethoxycarbonylamino)-6-propan-2-yloxyhexanoic acid (PubChem CID 137407851) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is (5S)-2,3-dimethylidene-6-oxo-5-(phenylmethoxycarbonylamino)-6-propan-2-yloxyhexanoic acid.
| Compound Name | (5S)-2,3-dimethylidene-6-oxo-5-(phenylmethoxycarbonylamino)-6-propan-2-yloxyhexanoic acid |
|---|---|
| PubChem CID | 137407851 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | (5S)-2,3-dimethylidene-6-oxo-5-(phenylmethoxycarbonylamino)-6-propan-2-yloxyhexanoic acid |
| SMILES | C=C(C[C@H](NC(=O)OCc1ccccc1)C(=O)OC(C)C)C(=C)C(=O)O |
| InChI | InChI=1S/C19H23NO6/c1-12(2)26-18(23)16(10-13(3)14(4)17(21)22)20-19(24)25-11-15-8-6-5-7-9-15/h5-9,12,16H,3-4,10-11H2,1-2H3,(H,20,24)(H,21,22)/t16-/m0/s1 |
| InChIKey | YXGMHBUIZYOJMA-INIZCTEOSA-N |
| XLogP | 2.82 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|