C21H22ClF2N3O3 — CID 137412322
(2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(3-fluoro-4-methoxypiperidine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienamide (PubChem CID 137412322) has the molecular formula C21H22ClF2N3O3 and a molecular weight of 437.87 g/mol. Its IUPAC name is (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(3-fluoro-4-methoxypiperidine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienamide.
| Compound Name | (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(3-fluoro-4-methoxypiperidine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienamide |
|---|---|
| PubChem CID | 137412322 |
| Molecular Formula | C21H22ClF2N3O3 |
| Molecular Weight | 437.87 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (2E,4Z,6Z)-4-chloro-8-[2-fluoro-4-(3-fluoro-4-methoxypiperidine-1-carbonyl)phenyl]-8-iminoocta-2,4,6-trienamide |
| SMILES | [H]/N=C(\C=C/C=C(Cl)/C=C/C(N)=O)c1ccc(C(=O)N2CCC(OC)C(F)C2)cc1F |
| InChI | InChI=1S/C21H22ClF2N3O3/c1-30-19-9-10-27(12-17(19)24)21(29)13-5-7-15(16(23)11-13)18(25)4-2-3-14(22)6-8-20(26)28/h2-8,11,17,19,25H,9-10,12H2,1H3,(H2,26,28)/b4-2-,8-6+,14-3-,25-18+ |
| InChIKey | VIHPLMWXSNFQIL-RKRMFKCPSA-N |
| XLogP | 3.11 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|