C25H38N10OS — CID 137412807
(2R)-2-[[4-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-(octylamino)methyl]amino]-5H-pyrrolo[3,2-d]pyrimidin-7-yl]methylamino]-3-sulfanylpropan-1-ol (PubChem CID 137412807) has the molecular formula C25H38N10OS and a molecular weight of 526.72 g/mol. Its IUPAC name is (2R)-2-[[4-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-(octylamino)methyl]amino]-5H-pyrrolo[3,2-d]pyrimidin-7-yl]methylamino]-3-sulfanylpropan-1-ol.
| Compound Name | (2R)-2-[[4-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-(octylamino)methyl]amino]-5H-pyrrolo[3,2-d]pyrimidin-7-yl]methylamino]-3-sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 137412807 |
| Molecular Formula | C25H38N10OS |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | (2R)-2-[[4-[[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)-(octylamino)methyl]amino]-5H-pyrrolo[3,2-d]pyrimidin-7-yl]methylamino]-3-sulfanylpropan-1-ol |
| SMILES | CCCCCCCCNC(Nc1ncnc2c(CN[C@H](CO)CS)c[nH]c12)c1c[nH]c2c(N)ncnc12 |
| InChI | InChI=1S/C25H38N10OS/c1-2-3-4-5-6-7-8-27-24(18-11-30-21-20(18)32-14-33-23(21)26)35-25-22-19(31-15-34-25)16(10-29-22)9-28-17(12-36)13-37/h10-11,14-15,17,24,27-30,36-37H,2-9,12-13H2,1H3,(H2,26,32,33)(H,31,34,35)/t17-,24?/m1/s1 |
| InChIKey | OUZHCJOZCXBLDG-BPNWFJGMSA-N |
| XLogP | 3.25 |
| TPSA | 165.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|