C14H15F2I2NO — CID 137427140
N-cyclohexyl-2,3-difluoro-5,6-diiodo-4-methylbenzamide (PubChem CID 137427140) has the molecular formula C14H15F2I2NO and a molecular weight of 505.08 g/mol. Its IUPAC name is N-cyclohexyl-2,3-difluoro-5,6-diiodo-4-methylbenzamide.
| Compound Name | N-cyclohexyl-2,3-difluoro-5,6-diiodo-4-methylbenzamide |
|---|---|
| PubChem CID | 137427140 |
| Molecular Formula | C14H15F2I2NO |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.92 |
| IUPAC Name | N-cyclohexyl-2,3-difluoro-5,6-diiodo-4-methylbenzamide |
| SMILES | Cc1c(F)c(F)c(C(=O)NC2CCCCC2)c(I)c1I |
| InChI | InChI=1S/C14H15F2I2NO/c1-7-10(15)11(16)9(13(18)12(7)17)14(20)19-8-5-3-2-4-6-8/h8H,2-6H2,1H3,(H,19,20) |
| InChIKey | ZTAQDZDVKXWBGF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|