C17H12ClN5 — CID 137430161
5-(8-chloroquinolin-6-yl)-6-pyrrol-1-ylpyrazin-2-amine (PubChem CID 137430161) has the molecular formula C17H12ClN5 and a molecular weight of 321.77 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-6-pyrrol-1-ylpyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-6-pyrrol-1-ylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430161 |
| Molecular Formula | C17H12ClN5 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-6-pyrrol-1-ylpyrazin-2-amine |
| SMILES | Nc1cnc(-c2cc(Cl)c3ncccc3c2)c(-n2cccc2)n1 |
| InChI | InChI=1S/C17H12ClN5/c18-13-9-12(8-11-4-3-5-20-15(11)13)16-17(22-14(19)10-21-16)23-6-1-2-7-23/h1-10H,(H2,19,22) |
| InChIKey | IXFUEWXTDBZLPZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |