C23H30N4O3 — CID 137432702
N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-[ethyl(2-methoxyethyl)amino]-2-(3-methoxyphenyl)acetamide (PubChem CID 137432702) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-[ethyl(2-methoxyethyl)amino]-2-(3-methoxyphenyl)acetamide.
| Compound Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-[ethyl(2-methoxyethyl)amino]-2-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 137432702 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | N-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]phenyl]-2-[ethyl(2-methoxyethyl)amino]-2-(3-methoxyphenyl)acetamide |
| SMILES | [H]/N=C/C(=C\N)c1ccc(NC(=O)C(c2cccc(OC)c2)N(CC)CCOC)cc1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-27(12-13-29-2)22(18-6-5-7-21(14-18)30-3)23(28)26-20-10-8-17(9-11-20)19(15-24)16-25/h5-11,14-16,22,24H,4,12-13,25H2,1-3H3,(H,26,28)/b19-16+,24-15+ |
| InChIKey | JKIHLNBWHDUVGS-MAUBWLBLSA-N |
| XLogP | 3.29 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|