C14H20N4 — CID 137446337
(Z,3E)-3-[(Z)-ethylidenehydrazinylidene]-N,N-dimethyl-2-(6-methyl-3-pyridinyl)but-1-en-1-amine (PubChem CID 137446337) has the molecular formula C14H20N4 and a molecular weight of 244.34 g/mol. Its IUPAC name is (Z,3E)-3-[(Z)-ethylidenehydrazinylidene]-N,N-dimethyl-2-(6-methyl-3-pyridinyl)but-1-en-1-amine.
| Compound Name | (Z,3E)-3-[(Z)-ethylidenehydrazinylidene]-N,N-dimethyl-2-(6-methyl-3-pyridinyl)but-1-en-1-amine |
|---|---|
| PubChem CID | 137446337 |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | (Z,3E)-3-[(Z)-ethylidenehydrazinylidene]-N,N-dimethyl-2-(6-methyl-3-pyridinyl)but-1-en-1-amine |
| SMILES | C/C=N\N=C(C)\C(=C/N(C)C)c1ccc(C)nc1 |
| InChI | InChI=1S/C14H20N4/c1-6-16-17-12(3)14(10-18(4)5)13-8-7-11(2)15-9-13/h6-10H,1-5H3/b14-10+,16-6-,17-12+ |
| InChIKey | FGQUHOJWSJGTGT-SSLWRJLCSA-N |
| XLogP | 2.76 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|