C19H25BrF2N4O6 — CID 137446657
dimethyl (Z)-2-amino-3-[amino-[2-(5-bromo-2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]but-2-enedioate (PubChem CID 137446657) has the molecular formula C19H25BrF2N4O6 and a molecular weight of 523.33 g/mol. Its IUPAC name is dimethyl (Z)-2-amino-3-[amino-[2-(5-bromo-2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-amino-3-[amino-[2-(5-bromo-2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]but-2-enedioate |
|---|---|
| PubChem CID | 137446657 |
| Molecular Formula | C19H25BrF2N4O6 |
| Molecular Weight | 523.33 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | dimethyl (Z)-2-amino-3-[amino-[2-(5-bromo-2,3-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]amino]but-2-enedioate |
| SMILES | COC(=O)/C(N)=C(\C(=O)OC)N(N)CC(NC(=O)OC(C)(C)C)c1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C19H25BrF2N4O6/c1-19(2,3)32-18(29)25-12(10-6-9(20)7-11(21)13(10)22)8-26(24)15(17(28)31-5)14(23)16(27)30-4/h6-7,12H,8,23-24H2,1-5H3,(H,25,29)/b15-14- |
| InChIKey | TXLRUTFMDLVVRX-PFONDFGASA-N |
| XLogP | 1.99 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|