C31H30N2O5 — CID 137451014
4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde (PubChem CID 137451014) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde.
| Compound Name | 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 137451014 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde |
| SMILES | O=Cc1ccc(CNCCc2ccc3c(c2)OCO3)c2c(CNCCc3ccc4c(c3)OCO4)cccc12 |
| InChI | InChI=1S/C31H30N2O5/c34-18-25-7-6-24(17-33-13-11-22-5-9-28-30(15-22)38-20-36-28)31-23(2-1-3-26(25)31)16-32-12-10-21-4-8-27-29(14-21)37-19-35-27/h1-9,14-15,18,32-33H,10-13,16-17,19-20H2 |
| InChIKey | FQYPZBXVCKLBKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|