About 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde
4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde (PubChem CID 137451014) has the molecular formula C31H30N2O5
and a molecular weight of 510.59 g/mol. Its IUPAC name is 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde |
| PubChem CID | 137451014 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde |
| SMILES | O=Cc1ccc(CNCCc2ccc3c(c2)OCO3)c2c(CNCCc3ccc4c(c3)OCO4)cccc12 |
| InChI | InChI=1S/C31H30N2O5/c34-18-25-7-6-24(17-33-13-11-22-5-9-28-30(15-22)38-20-36-28)31-23(2-1-3-26(25)31)16-32-12-10-21-4-8-27-29(14-21)37-19-35-27/h1-9,14-15,18,32-33H,10-13,16-17,19-20H2 |
| InChIKey | FQYPZBXVCKLBKC-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde?
The IUPAC name of 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde (CID 137451014) is 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde.
What is the SMILES notation for 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde?
The canonical SMILES for 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde is O=Cc1ccc(CNCCc2ccc3c(c2)OCO3)c2c(CNCCc3ccc4c(c3)OCO4)cccc12.
What is the InChIKey of 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde?
The InChIKey is FQYPZBXVCKLBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H30N2O5/c34-18-25-7-6-24(17-33-13-11-22-5-9-28-30(15-22)38-20-36-28)31-23(2-1-3-26(25)31)16-32-12-10-21-4-8-27-29(14-21)37-19-35-27/h1-9,14-15,18,32-33H,10-13,16-17,19-20H2.
What are the key properties of 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde?
4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde has a molecular weight of 510.59 g/mol, XLogP of 4.77, 11 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis[[2-(1,3-benzodioxol-5-yl)ethylamino]methyl]naphthalene-1-carbaldehyde is sourced from PubChem (CID 137451014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).