C16H13F7N2O2S — CID 137462583
N-[2-[3,4-bis(trifluoromethyl)anilino]ethyl]-4-fluorobenzenesulfonamide (PubChem CID 137462583) has the molecular formula C16H13F7N2O2S and a molecular weight of 430.35 g/mol. Its IUPAC name is N-[2-[3,4-bis(trifluoromethyl)anilino]ethyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[3,4-bis(trifluoromethyl)anilino]ethyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 137462583 |
| Molecular Formula | C16H13F7N2O2S |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-[2-[3,4-bis(trifluoromethyl)anilino]ethyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(C(F)(F)F)c(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H13F7N2O2S/c17-10-1-4-12(5-2-10)28(26,27)25-8-7-24-11-3-6-13(15(18,19)20)14(9-11)16(21,22)23/h1-6,9,24-25H,7-8H2 |
| InChIKey | SRVRZGMFBHEGSJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|