C14H22N2O4 — CID 137464720
(2S)-2-amino-6-(spiro[2.3]hex-1-en-5-ylmethoxycarbonylamino)hexanoic acid (PubChem CID 137464720) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S)-2-amino-6-(spiro[2.3]hex-1-en-5-ylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-amino-6-(spiro[2.3]hex-1-en-5-ylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 137464720 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (2S)-2-amino-6-(spiro[2.3]hex-1-en-5-ylmethoxycarbonylamino)hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)OCC1CC2(C=C2)C1)C(=O)O |
| InChI | InChI=1S/C14H22N2O4/c15-11(12(17)18)3-1-2-6-16-13(19)20-9-10-7-14(8-10)4-5-14/h4-5,10-11H,1-3,6-9,15H2,(H,16,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | GRRGXEAFBPMUKG-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|