C24H37O5P — CID 137467512
[2,2-dimethyl-3-[(Z)-3-methyl-4-phosphanylbut-3-enyl]-7-pentyl-3,4-dihydrochromen-5-yl] 2,3-dihydroxypropanoate (PubChem CID 137467512) has the molecular formula C24H37O5P and a molecular weight of 436.53 g/mol. Its IUPAC name is [2,2-dimethyl-3-[(Z)-3-methyl-4-phosphanylbut-3-enyl]-7-pentyl-3,4-dihydrochromen-5-yl] 2,3-dihydroxypropanoate.
| Compound Name | [2,2-dimethyl-3-[(Z)-3-methyl-4-phosphanylbut-3-enyl]-7-pentyl-3,4-dihydrochromen-5-yl] 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 137467512 |
| Molecular Formula | C24H37O5P |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [2,2-dimethyl-3-[(Z)-3-methyl-4-phosphanylbut-3-enyl]-7-pentyl-3,4-dihydrochromen-5-yl] 2,3-dihydroxypropanoate |
| SMILES | CCCCCc1cc(OC(=O)C(O)CO)c2c(c1)OC(C)(C)C(CC/C(C)=C\P)C2 |
| InChI | InChI=1S/C24H37O5P/c1-5-6-7-8-17-11-21(28-23(27)20(26)14-25)19-13-18(10-9-16(2)15-30)24(3,4)29-22(19)12-17/h11-12,15,18,20,25-26H,5-10,13-14,30H2,1-4H3/b16-15- |
| InChIKey | MIEFAWBMIRTJMH-NXVVXOECSA-N |
| XLogP | 4.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|