C23H38O2 — CID 70862013
2,2,4-trimethyl-6-(2-methylbutan-2-yloxy)-8-pentyl-4,5-dihydro-3H-1-benzoxepine (PubChem CID 70862013) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-(2-methylbutan-2-yloxy)-8-pentyl-4,5-dihydro-3H-1-benzoxepine.
| Compound Name | 2,2,4-trimethyl-6-(2-methylbutan-2-yloxy)-8-pentyl-4,5-dihydro-3H-1-benzoxepine |
|---|---|
| PubChem CID | 70862013 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2,2,4-trimethyl-6-(2-methylbutan-2-yloxy)-8-pentyl-4,5-dihydro-3H-1-benzoxepine |
| SMILES | CCCCCc1cc(OC(C)(C)CC)c2c(c1)OC(C)(C)CC(C)C2 |
| InChI | InChI=1S/C23H38O2/c1-8-10-11-12-18-14-20(24-22(4,5)9-2)19-13-17(3)16-23(6,7)25-21(19)15-18/h14-15,17H,8-13,16H2,1-7H3 |
| InChIKey | CNNXJFRKTMLXFB-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|