C33H58O3Si2 — CID 91751564
[(6aS,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 91751564) has the molecular formula C33H58O3Si2 and a molecular weight of 559.00 g/mol. Its IUPAC name is [(6aS,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6aS,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 91751564 |
| Molecular Formula | C33H58O3Si2 |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | [(6aS,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCc1cc2c(c(O[Si](C)(C)C(C)(C)C)c1)[C@@H]1C=C(C)CC(O[Si](C)(C)C(C)(C)C)[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C33H58O3Si2/c1-15-16-17-18-24-21-26-29(27(22-24)35-37(11,12)31(3,4)5)25-19-23(2)20-28(30(25)33(9,10)34-26)36-38(13,14)32(6,7)8/h19,21-22,25,28,30H,15-18,20H2,1-14H3/t25-,28?,30-/m0/s1 |
| InChIKey | NJYOJCSBHZZTCW-NFUCCUETSA-N |
| XLogP | 10.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|