C29H46O4Si — CID 71314381
ethyl (6aR,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-9-carboxylate (PubChem CID 71314381) has the molecular formula C29H46O4Si and a molecular weight of 486.77 g/mol. Its IUPAC name is ethyl (6aR,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-9-carboxylate.
| Compound Name | ethyl (6aR,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-9-carboxylate |
|---|---|
| PubChem CID | 71314381 |
| Molecular Formula | C29H46O4Si |
| Molecular Weight | 486.77 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | ethyl (6aR,10aR)-1-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-9-carboxylate |
| SMILES | CCCCCc1cc2c(c(O[Si](C)(C)C(C)(C)C)c1)[C@@H]1C=C(C(=O)OCC)CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C29H46O4Si/c1-10-12-13-14-20-17-24-26(25(18-20)33-34(8,9)28(3,4)5)22-19-21(27(30)31-11-2)15-16-23(22)29(6,7)32-24/h17-19,22-23H,10-16H2,1-9H3/t22-,23-/m1/s1 |
| InChIKey | HFGATAWDKZPRPB-DHIUTWEWSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.77 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|