C25H40O3Si2 — CID 136799204
CID 136799204 (PubChem CID 136799204) has the molecular formula C25H40O3Si2 and a molecular weight of 444.76 g/mol.
| Compound Name | CID 136799204 |
|---|---|
| PubChem CID | 136799204 |
| Molecular Formula | C25H40O3Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | — |
| SMILES | CCCCCc1cc(O[Si](C)C)c2c(c1)OC(C)(C)[C@@H]1CCC(CO[Si](C)C)=C[C@@H]21 |
| InChI | InChI=1S/C25H40O3Si2/c1-8-9-10-11-18-15-22-24(23(16-18)28-30(6)7)20-14-19(17-26-29(4)5)12-13-21(20)25(2,3)27-22/h14-16,20-21H,8-13,17H2,1-7H3/t20-,21-/m1/s1 |
| InChIKey | KFLFIKRBQTVDLE-NHCUHLMSSA-N |
| XLogP | 6.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|