C33H58O3Si2 — CID 634665
triethyl-[(6,6,9-trimethyl-3-pentyl-1-triethylsilyloxy-6a,7,8,10a-tetrahydrobenzo[c]chromen-8-yl)oxy]silane (PubChem CID 634665) has the molecular formula C33H58O3Si2 and a molecular weight of 559.00 g/mol. Its IUPAC name is triethyl-[(6,6,9-trimethyl-3-pentyl-1-triethylsilyloxy-6a,7,8,10a-tetrahydrobenzo[c]chromen-8-yl)oxy]silane.
| Compound Name | triethyl-[(6,6,9-trimethyl-3-pentyl-1-triethylsilyloxy-6a,7,8,10a-tetrahydrobenzo[c]chromen-8-yl)oxy]silane |
|---|---|
| PubChem CID | 634665 |
| Molecular Formula | C33H58O3Si2 |
| Molecular Weight | 559.00 g/mol |
| Exact Mass | 558.39 |
| IUPAC Name | triethyl-[(6,6,9-trimethyl-3-pentyl-1-triethylsilyloxy-6a,7,8,10a-tetrahydrobenzo[c]chromen-8-yl)oxy]silane |
| SMILES | CCCCCc1cc2c(c(O[Si](CC)(CC)CC)c1)C1C=C(C)C(O[Si](CC)(CC)CC)CC1C(C)(C)O2 |
| InChI | InChI=1S/C33H58O3Si2/c1-11-18-19-20-26-22-30-32(31(23-26)36-38(15-5,16-6)17-7)27-21-25(8)29(24-28(27)33(9,10)34-30)35-37(12-2,13-3)14-4/h21-23,27-29H,11-20,24H2,1-10H3 |
| InChIKey | YMAHURPNACDNQA-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.00 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|